C12H15F2N3O — CID 43765044
4-(3,5-difluoroanilino)piperidine-1-carboxamide (PubChem CID 43765044) has the molecular formula C12H15F2N3O and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-(3,5-difluoroanilino)piperidine-1-carboxamide.
| Compound Name | 4-(3,5-difluoroanilino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 43765044 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-(3,5-difluoroanilino)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(Nc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C12H15F2N3O/c13-8-5-9(14)7-11(6-8)16-10-1-3-17(4-2-10)12(15)18/h5-7,10,16H,1-4H2,(H2,15,18) |
| InChIKey | GTNXQMGJBHPYNO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |