C13H17F2N3O2 — CID 43783712
4-[3-(difluoromethoxy)anilino]piperidine-1-carboxamide (PubChem CID 43783712) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 4-[3-(difluoromethoxy)anilino]piperidine-1-carboxamide.
| Compound Name | 4-[3-(difluoromethoxy)anilino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 43783712 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-[3-(difluoromethoxy)anilino]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(Nc2cccc(OC(F)F)c2)CC1 |
| InChI | InChI=1S/C13H17F2N3O2/c14-12(15)20-11-3-1-2-10(8-11)17-9-4-6-18(7-5-9)13(16)19/h1-3,8-9,12,17H,4-7H2,(H2,16,19) |
| InChIKey | HGFPWGYIYRSHES-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |