C20H22F2N2O3 — CID 114280142
benzyl 4-[3-(difluoromethoxy)anilino]piperidine-1-carboxylate (PubChem CID 114280142) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is benzyl 4-[3-(difluoromethoxy)anilino]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[3-(difluoromethoxy)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 114280142 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | benzyl 4-[3-(difluoromethoxy)anilino]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(Nc2cccc(OC(F)F)c2)CC1 |
| InChI | InChI=1S/C20H22F2N2O3/c21-19(22)27-18-8-4-7-17(13-18)23-16-9-11-24(12-10-16)20(25)26-14-15-5-2-1-3-6-15/h1-8,13,16,19,23H,9-12,14H2 |
| InChIKey | SYGVNPUIXAXGHZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |