C32H34F2IN3O5 — CID 68733292
benzyl 4-(3,4-difluoroanilino)piperidine-1-carboxylate;benzyl 2-iodo-4-oxopiperidine-1-carboxylate (PubChem CID 68733292) has the molecular formula C32H34F2IN3O5 and a molecular weight of 705.54 g/mol. Its IUPAC name is benzyl 4-(3,4-difluoroanilino)piperidine-1-carboxylate;benzyl 2-iodo-4-oxopiperidine-1-carboxylate.
| Compound Name | benzyl 4-(3,4-difluoroanilino)piperidine-1-carboxylate;benzyl 2-iodo-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68733292 |
| Molecular Formula | C32H34F2IN3O5 |
| Molecular Weight | 705.54 g/mol |
| Exact Mass | 705.15 |
| IUPAC Name | benzyl 4-(3,4-difluoroanilino)piperidine-1-carboxylate;benzyl 2-iodo-4-oxopiperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(Nc2ccc(F)c(F)c2)CC1.O=C1CCN(C(=O)OCc2ccccc2)C(I)C1 |
| InChI | InChI=1S/C19H20F2N2O2.C13H14INO3/c20-17-7-6-16(12-18(17)21)22-15-8-10-23(11-9-15)19(24)25-13-14-4-2-1-3-5-14;14-12-8-11(16)6-7-15(12)13(17)18-9-10-4-2-1-3-5-10/h1-7,12,15,22H,8-11,13H2;1-5,12H,6-9H2 |
| InChIKey | VORGYRGBFBENLO-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.54 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|