C14H20N4O3 — CID 60942471
methyl N-[3-[(1-carbamoylpiperidin-4-yl)amino]phenyl]carbamate (PubChem CID 60942471) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl N-[3-[(1-carbamoylpiperidin-4-yl)amino]phenyl]carbamate.
| Compound Name | methyl N-[3-[(1-carbamoylpiperidin-4-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 60942471 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | methyl N-[3-[(1-carbamoylpiperidin-4-yl)amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NC2CCN(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C14H20N4O3/c1-21-14(20)17-12-4-2-3-11(9-12)16-10-5-7-18(8-6-10)13(15)19/h2-4,9-10,16H,5-8H2,1H3,(H2,15,19)(H,17,20) |
| InChIKey | UUQNQRLEVVBGBU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |