C14H14F6N2O2 — CID 89332293
4-[3,5-bis(trifluoromethyl)phenoxy]piperidine-1-carboxamide (PubChem CID 89332293) has the molecular formula C14H14F6N2O2 and a molecular weight of 356.27 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenoxy]piperidine-1-carboxamide.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenoxy]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 89332293 |
| Molecular Formula | C14H14F6N2O2 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenoxy]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H14F6N2O2/c15-13(16,17)8-5-9(14(18,19)20)7-11(6-8)24-10-1-3-22(4-2-10)12(21)23/h5-7,10H,1-4H2,(H2,21,23) |
| InChIKey | IQEINVHFWHBBMP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |