C21H21F3N2O4 — CID 67170684
4-[4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine-1-carbonyl]benzamide (PubChem CID 67170684) has the molecular formula C21H21F3N2O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is 4-[4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine-1-carbonyl]benzamide.
| Compound Name | 4-[4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 67170684 |
| Molecular Formula | C21H21F3N2O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-[4-[3-(2,2,2-trifluoroethoxy)phenoxy]piperidine-1-carbonyl]benzamide |
| SMILES | NC(=O)c1ccc(C(=O)N2CCC(Oc3cccc(OCC(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H21F3N2O4/c22-21(23,24)13-29-17-2-1-3-18(12-17)30-16-8-10-26(11-9-16)20(28)15-6-4-14(5-7-15)19(25)27/h1-7,12,16H,8-11,13H2,(H2,25,27) |
| InChIKey | UDVGDWOJKSBCNP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |