C12H13F3N2O2 — CID 67479763
2-amino-1-[3-[3-(trifluoromethyl)phenoxy]azetidin-1-yl]ethanone (PubChem CID 67479763) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-amino-1-[3-[3-(trifluoromethyl)phenoxy]azetidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[3-[3-(trifluoromethyl)phenoxy]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 67479763 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-amino-1-[3-[3-(trifluoromethyl)phenoxy]azetidin-1-yl]ethanone |
| SMILES | NCC(=O)N1CC(Oc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)8-2-1-3-9(4-8)19-10-6-17(7-10)11(18)5-16/h1-4,10H,5-7,16H2 |
| InChIKey | QDQMTEJVJYNPPB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |