C19H19F3N2O2 — CID 70736464
2-pyridin-3-yl-1-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone (PubChem CID 70736464) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-pyridin-3-yl-1-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70736464 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-pyridin-3-yl-1-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1cccnc1)N1CCC(Oc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H19F3N2O2/c20-19(21,22)15-4-1-5-17(12-15)26-16-6-9-24(10-7-16)18(25)11-14-3-2-8-23-13-14/h1-5,8,12-13,16H,6-7,9-11H2 |
| InChIKey | QVDBNOPBXMOADR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |