C15H16N4O2 — CID 100753789
1-[(3S)-3-pyrazin-2-yloxypyrrolidin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 100753789) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-[(3S)-3-pyrazin-2-yloxypyrrolidin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(3S)-3-pyrazin-2-yloxypyrrolidin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 100753789 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-[(3S)-3-pyrazin-2-yloxypyrrolidin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CC[C@H](Oc2cnccn2)C1 |
| InChI | InChI=1S/C15H16N4O2/c20-15(8-12-2-1-4-16-9-12)19-7-3-13(11-19)21-14-10-17-5-6-18-14/h1-2,4-6,9-10,13H,3,7-8,11H2/t13-/m0/s1 |
| InChIKey | OYTODGHALHQDCZ-ZDUSSCGKSA-N |
| XLogP | 1.09 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |