C16H17N3O3 — CID 90636253
benzyl 3-pyrazin-2-yloxypyrrolidine-1-carboxylate (PubChem CID 90636253) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is benzyl 3-pyrazin-2-yloxypyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-pyrazin-2-yloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90636253 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | benzyl 3-pyrazin-2-yloxypyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(Oc2cnccn2)C1 |
| InChI | InChI=1S/C16H17N3O3/c20-16(21-12-13-4-2-1-3-5-13)19-9-6-14(11-19)22-15-10-17-7-8-18-15/h1-5,7-8,10,14H,6,9,11-12H2 |
| InChIKey | TWIJKZRSMYPARQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |