C12H15N3O4 — CID 90636072
ethyl 2-oxo-2-(3-pyrazin-2-yloxypyrrolidin-1-yl)acetate (PubChem CID 90636072) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is ethyl 2-oxo-2-(3-pyrazin-2-yloxypyrrolidin-1-yl)acetate.
| Compound Name | ethyl 2-oxo-2-(3-pyrazin-2-yloxypyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 90636072 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | ethyl 2-oxo-2-(3-pyrazin-2-yloxypyrrolidin-1-yl)acetate |
| SMILES | CCOC(=O)C(=O)N1CCC(Oc2cnccn2)C1 |
| InChI | InChI=1S/C12H15N3O4/c1-2-18-12(17)11(16)15-6-3-9(8-15)19-10-7-13-4-5-14-10/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | AFSOGMOKUWJUIA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|