C15H19N5O4 — CID 90636347
1-ethyl-4-(3-pyrazin-2-yloxypyrrolidine-1-carbonyl)piperazine-2,3-dione (PubChem CID 90636347) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-ethyl-4-(3-pyrazin-2-yloxypyrrolidine-1-carbonyl)piperazine-2,3-dione.
| Compound Name | 1-ethyl-4-(3-pyrazin-2-yloxypyrrolidine-1-carbonyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 90636347 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-ethyl-4-(3-pyrazin-2-yloxypyrrolidine-1-carbonyl)piperazine-2,3-dione |
| SMILES | CCN1CCN(C(=O)N2CCC(Oc3cnccn3)C2)C(=O)C1=O |
| InChI | InChI=1S/C15H19N5O4/c1-2-18-7-8-20(14(22)13(18)21)15(23)19-6-3-11(10-19)24-12-9-16-4-5-17-12/h4-5,9,11H,2-3,6-8,10H2,1H3 |
| InChIKey | NFORLCXVLZHAOR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|