C18H23F3N2O3 — CID 70714144
2-morpholin-2-yl-1-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone (PubChem CID 70714144) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-morpholin-2-yl-1-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-morpholin-2-yl-1-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70714144 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-morpholin-2-yl-1-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone |
| SMILES | O=C(CC1CNCCO1)N1CCC(Oc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H23F3N2O3/c19-18(20,21)13-2-1-3-15(10-13)26-14-4-7-23(8-5-14)17(24)11-16-12-22-6-9-25-16/h1-3,10,14,16,22H,4-9,11-12H2 |
| InChIKey | RYPOBIJDUVNPAP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |