C17H15F3N2O2 — CID 155800940
1-(3-pyridin-4-yloxyazetidin-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 155800940) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is 1-(3-pyridin-4-yloxyazetidin-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(3-pyridin-4-yloxyazetidin-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 155800940 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-(3-pyridin-4-yloxyazetidin-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)N1CC(Oc2ccncc2)C1 |
| InChI | InChI=1S/C17H15F3N2O2/c18-17(19,20)13-3-1-2-12(8-13)9-16(23)22-10-15(11-22)24-14-4-6-21-7-5-14/h1-8,15H,9-11H2 |
| InChIKey | BZVFMESCAMFKJV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |