C12H11F6NO3 — CID 130472690
2,2,2-trifluoroacetic acid;3-[3-(trifluoromethyl)phenoxy]azetidine (PubChem CID 130472690) has the molecular formula C12H11F6NO3 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;3-[3-(trifluoromethyl)phenoxy]azetidine.
| Compound Name | 2,2,2-trifluoroacetic acid;3-[3-(trifluoromethyl)phenoxy]azetidine |
|---|---|
| PubChem CID | 130472690 |
| Molecular Formula | C12H11F6NO3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;3-[3-(trifluoromethyl)phenoxy]azetidine |
| SMILES | FC(F)(F)c1cccc(OC2CNC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO.C2HF3O2/c11-10(12,13)7-2-1-3-8(4-7)15-9-5-14-6-9;3-2(4,5)1(6)7/h1-4,9,14H,5-6H2;(H,6,7) |
| InChIKey | IZVWERJUVHUGOA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |