C13H14F3NO5 — CID 67885896
(2R,3S)-2-methyl-3-[3-(trifluoromethyl)phenoxy]azetidine;oxalic acid (PubChem CID 67885896) has the molecular formula C13H14F3NO5 and a molecular weight of 321.25 g/mol. Its IUPAC name is (2R,3S)-2-methyl-3-[3-(trifluoromethyl)phenoxy]azetidine;oxalic acid.
| Compound Name | (2R,3S)-2-methyl-3-[3-(trifluoromethyl)phenoxy]azetidine;oxalic acid |
|---|---|
| PubChem CID | 67885896 |
| Molecular Formula | C13H14F3NO5 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (2R,3S)-2-methyl-3-[3-(trifluoromethyl)phenoxy]azetidine;oxalic acid |
| SMILES | C[C@H]1NC[C@@H]1Oc1cccc(C(F)(F)F)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H12F3NO.C2H2O4/c1-7-10(6-15-7)16-9-4-2-3-8(5-9)11(12,13)14;3-1(4)2(5)6/h2-5,7,10,15H,6H2,1H3;(H,3,4)(H,5,6)/t7-,10+;/m1./s1 |
| InChIKey | GFXNKSBVXOYJNM-QJVKKXMWSA-N |
| XLogP | 1.60 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|