C15H17F3N2O2 — CID 15053358
(2R,3R)-2-methyl-N-prop-2-enyl-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide (PubChem CID 15053358) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is (2R,3R)-2-methyl-N-prop-2-enyl-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide.
| Compound Name | (2R,3R)-2-methyl-N-prop-2-enyl-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 15053358 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2R,3R)-2-methyl-N-prop-2-enyl-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1C[C@@H](Oc2cccc(C(F)(F)F)c2)[C@H]1C |
| InChI | InChI=1S/C15H17F3N2O2/c1-3-7-19-14(21)20-9-13(10(20)2)22-12-6-4-5-11(8-12)15(16,17)18/h3-6,8,10,13H,1,7,9H2,2H3,(H,19,21)/t10-,13-/m1/s1 |
| InChIKey | SYPFZJKKALJQSR-ZWNOBZJWSA-N |
| XLogP | 3.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|