C20H20F3NO6 — CID 70454092
(3R,4R)-1-benzyl-4-[3-(trifluoromethyl)phenoxy]pyrrolidin-3-ol;oxalic acid (PubChem CID 70454092) has the molecular formula C20H20F3NO6 and a molecular weight of 427.38 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-[3-(trifluoromethyl)phenoxy]pyrrolidin-3-ol;oxalic acid.
| Compound Name | (3R,4R)-1-benzyl-4-[3-(trifluoromethyl)phenoxy]pyrrolidin-3-ol;oxalic acid |
|---|---|
| PubChem CID | 70454092 |
| Molecular Formula | C20H20F3NO6 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (3R,4R)-1-benzyl-4-[3-(trifluoromethyl)phenoxy]pyrrolidin-3-ol;oxalic acid |
| SMILES | O=C(O)C(=O)O.O[C@@H]1CN(Cc2ccccc2)C[C@H]1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO2.C2H2O4/c19-18(20,21)14-7-4-8-15(9-14)24-17-12-22(11-16(17)23)10-13-5-2-1-3-6-13;3-1(4)2(5)6/h1-9,16-17,23H,10-12H2;(H,3,4)(H,5,6)/t16-,17-;/m1./s1 |
| InChIKey | YOVYVWUZPUTOSI-GBNZRNLASA-N |
| XLogP | 2.49 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|