C15H16F3NO2 — CID 166925172
N-[(3S)-3-[3-(trifluoromethyl)phenoxy]cyclopentyl]prop-2-enamide (PubChem CID 166925172) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-[(3S)-3-[3-(trifluoromethyl)phenoxy]cyclopentyl]prop-2-enamide.
| Compound Name | N-[(3S)-3-[3-(trifluoromethyl)phenoxy]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 166925172 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[(3S)-3-[3-(trifluoromethyl)phenoxy]cyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC[C@H](Oc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H16F3NO2/c1-2-14(20)19-11-6-7-13(9-11)21-12-5-3-4-10(8-12)15(16,17)18/h2-5,8,11,13H,1,6-7,9H2,(H,19,20)/t11?,13-/m0/s1 |
| InChIKey | OODPUINHZWPHGA-YUZLPWPTSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|