C16H23BO5 — CID 171373954
methyl 4-methoxy-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzoate (PubChem CID 171373954) has the molecular formula C16H23BO5 and a molecular weight of 306.17 g/mol. Its IUPAC name is methyl 4-methoxy-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzoate.
| Compound Name | methyl 4-methoxy-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 171373954 |
| Molecular Formula | C16H23BO5 |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | methyl 4-methoxy-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(OC)c(CB2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H23BO5/c1-15(2)16(3,4)22-17(21-15)10-12-9-11(14(18)20-6)7-8-13(12)19-5/h7-9H,10H2,1-6H3 |
| InChIKey | FMBIGORHGAPJDO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|