C15H19BO5 — CID 142525365
methyl 3-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 142525365) has the molecular formula C15H19BO5 and a molecular weight of 290.12 g/mol. Its IUPAC name is methyl 3-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 3-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 142525365 |
| Molecular Formula | C15H19BO5 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 3-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(C=O)c1 |
| InChI | InChI=1S/C15H19BO5/c1-14(2)15(3,4)21-16(20-14)12-7-6-10(13(18)19-5)8-11(12)9-17/h6-9H,1-5H3 |
| InChIKey | NSVZLEUJSLVBBJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|