C23H26BBrO6 — CID 175410296
methyl 4-[(2-bromo-6-formylphenyl)methoxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 175410296) has the molecular formula C23H26BBrO6 and a molecular weight of 489.17 g/mol. Its IUPAC name is methyl 4-[(2-bromo-6-formylphenyl)methoxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 4-[(2-bromo-6-formylphenyl)methoxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 175410296 |
| Molecular Formula | C23H26BBrO6 |
| Molecular Weight | 489.17 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | methyl 4-[(2-bromo-6-formylphenyl)methoxymethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(COCc2c(Br)cccc2C=O)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C23H26BBrO6/c1-22(2)23(3,4)31-24(30-22)19-11-15(21(27)28-5)9-10-17(19)13-29-14-18-16(12-26)7-6-8-20(18)25/h6-12H,13-14H2,1-5H3 |
| InChIKey | JCYJJSOMXGBBPQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|