C20H22BFO4 — CID 90206955
methyl 3-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate (PubChem CID 90206955) has the molecular formula C20H22BFO4 and a molecular weight of 356.20 g/mol. Its IUPAC name is methyl 3-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate.
| Compound Name | methyl 3-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 90206955 |
| Molecular Formula | C20H22BFO4 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | methyl 3-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(F)c(B3OC(C)(C)C(C)(C)O3)c2)c1 |
| InChI | InChI=1S/C20H22BFO4/c1-19(2)20(3,4)26-21(25-19)16-12-14(9-10-17(16)22)13-7-6-8-15(11-13)18(23)24-5/h6-12H,1-5H3 |
| InChIKey | DLLFQHXFGINVPW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|