C17H27BO4 — CID 153360804
ethane;methyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 153360804) has the molecular formula C17H27BO4 and a molecular weight of 306.21 g/mol. Its IUPAC name is ethane;methyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | ethane;methyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 153360804 |
| Molecular Formula | C17H27BO4 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | ethane;methyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CC.COC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C15H21BO4.C2H6/c1-10-9-11(13(17)18-6)7-8-12(10)16-19-14(2,3)15(4,5)20-16;1-2/h7-9H,1-6H3;1-2H3 |
| InChIKey | AIJVUHXSESWGHY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|