C17H21BN2O4 — CID 172645036
methyl 3-(1H-imidazol-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 172645036) has the molecular formula C17H21BN2O4 and a molecular weight of 328.18 g/mol. Its IUPAC name is methyl 3-(1H-imidazol-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 3-(1H-imidazol-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 172645036 |
| Molecular Formula | C17H21BN2O4 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | methyl 3-(1H-imidazol-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(-c2ncc[nH]2)c1 |
| InChI | InChI=1S/C17H21BN2O4/c1-16(2)17(3,4)24-18(23-16)13-7-6-11(15(21)22-5)10-12(13)14-19-8-9-20-14/h6-10H,1-5H3,(H,19,20) |
| InChIKey | XTXNBJLJQPJQAA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|