C16H21BN2O2 — CID 172644171
2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazole (PubChem CID 172644171) has the molecular formula C16H21BN2O2 and a molecular weight of 284.17 g/mol. Its IUPAC name is 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazole.
| Compound Name | 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 172644171 |
| Molecular Formula | C16H21BN2O2 |
| Molecular Weight | 284.17 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazole |
| SMILES | Cc1cc(-c2ncc[nH]2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H21BN2O2/c1-11-10-12(14-18-8-9-19-14)6-7-13(11)17-20-15(2,3)16(4,5)21-17/h6-10H,1-5H3,(H,18,19) |
| InChIKey | MIMIBWAJTJPMLW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|