C16H21BN2O3 — CID 172644599
2-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazole (PubChem CID 172644599) has the molecular formula C16H21BN2O3 and a molecular weight of 300.17 g/mol. Its IUPAC name is 2-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazole.
| Compound Name | 2-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 172644599 |
| Molecular Formula | C16H21BN2O3 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazole |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)cc(-c2ncc[nH]2)c1 |
| InChI | InChI=1S/C16H21BN2O3/c1-15(2)16(3,4)22-17(21-15)12-8-11(9-13(10-12)20-5)14-18-6-7-19-14/h6-10H,1-5H3,(H,18,19) |
| InChIKey | NJWJJKQPYBLDJF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|