C24H27BN2O3 — CID 68843961
2-[3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridin-3-amine (PubChem CID 68843961) has the molecular formula C24H27BN2O3 and a molecular weight of 402.30 g/mol. Its IUPAC name is 2-[3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridin-3-amine.
| Compound Name | 2-[3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 68843961 |
| Molecular Formula | C24H27BN2O3 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-[3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridin-3-amine |
| SMILES | CC1(C)OB(c2cc(OCc3ccccc3)cc(-c3ncccc3N)c2)OC1(C)C |
| InChI | InChI=1S/C24H27BN2O3/c1-23(2)24(3,4)30-25(29-23)19-13-18(22-21(26)11-8-12-27-22)14-20(15-19)28-16-17-9-6-5-7-10-17/h5-15H,16,26H2,1-4H3 |
| InChIKey | RSEXRJZTGXKQOE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|