C17H20BNO6 — CID 172868626
2-[3-(furan-2-ylmethoxy)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 172868626) has the molecular formula C17H20BNO6 and a molecular weight of 345.16 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethoxy)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(furan-2-ylmethoxy)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 172868626 |
| Molecular Formula | C17H20BNO6 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[3-(furan-2-ylmethoxy)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(OCc3ccco3)cc([N+](=O)[O-])c2)OC1(C)C |
| InChI | InChI=1S/C17H20BNO6/c1-16(2)17(3,4)25-18(24-16)12-8-13(19(20)21)10-15(9-12)23-11-14-6-5-7-22-14/h5-10H,11H2,1-4H3 |
| InChIKey | JBPFOXISWIQZEH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|