C19H20BNO6 — CID 59525492
4-(3-nitrophenoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 59525492) has the molecular formula C19H20BNO6 and a molecular weight of 369.18 g/mol. Its IUPAC name is 4-(3-nitrophenoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 4-(3-nitrophenoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 59525492 |
| Molecular Formula | C19H20BNO6 |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-(3-nitrophenoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CC1(C)OB(c2cc(Oc3cccc([N+](=O)[O-])c3)ccc2C=O)OC1(C)C |
| InChI | InChI=1S/C19H20BNO6/c1-18(2)19(3,4)27-20(26-18)17-11-16(9-8-13(17)12-22)25-15-7-5-6-14(10-15)21(23)24/h5-12H,1-4H3 |
| InChIKey | ADTHDECFRYAVSI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|