C35H38BBrO8 — CID 157476819
2-bromo-4-(3-methoxyphenoxy)benzaldehyde;methane;4-(3-methoxyphenoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 157476819) has the molecular formula C35H38BBrO8 and a molecular weight of 677.40 g/mol. Its IUPAC name is 2-bromo-4-(3-methoxyphenoxy)benzaldehyde;methane;4-(3-methoxyphenoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 2-bromo-4-(3-methoxyphenoxy)benzaldehyde;methane;4-(3-methoxyphenoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 157476819 |
| Molecular Formula | C35H38BBrO8 |
| Molecular Weight | 677.40 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | 2-bromo-4-(3-methoxyphenoxy)benzaldehyde;methane;4-(3-methoxyphenoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | C.COc1cccc(Oc2ccc(C=O)c(B3OC(C)(C)C(C)(C)O3)c2)c1.COc1cccc(Oc2ccc(C=O)c(Br)c2)c1 |
| InChI | InChI=1S/C20H23BO5.C14H11BrO3.CH4/c1-19(2)20(3,4)26-21(25-19)18-12-17(10-9-14(18)13-22)24-16-8-6-7-15(11-16)23-5;1-17-11-3-2-4-12(7-11)18-13-6-5-10(9-16)14(15)8-13;/h6-13H,1-5H3;2-9H,1H3;1H4 |
| InChIKey | BVROIGPFNNORFI-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.40 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|