About 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride
2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride (PubChem CID 139785129) has the molecular formula C11H14Cl2N2O2
and a molecular weight of 277.15 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride |
| PubChem CID | 139785129 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride |
| SMILES | COc1cc(OC)cc(-c2ncc[nH]2)c1.Cl.Cl |
| InChI | InChI=1S/C11H12N2O2.2ClH/c1-14-9-5-8(6-10(7-9)15-2)11-12-3-4-13-11;;/h3-7H,1-2H3,(H,12,13);2*1H |
| InChIKey | WISFFHXMSYHBBP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride?
The IUPAC name of 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride (CID 139785129) is 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride.
What is the SMILES notation for 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride?
The canonical SMILES for 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride is COc1cc(OC)cc(-c2ncc[nH]2)c1.Cl.Cl.
What is the InChIKey of 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride?
The InChIKey is WISFFHXMSYHBBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2.2ClH/c1-14-9-5-8(6-10(7-9)15-2)11-12-3-4-13-11;;/h3-7H,1-2H3,(H,12,13);2*1H.
What are the key properties of 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride?
2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride has a molecular weight of 277.15 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethoxyphenyl)-1H-imidazole;dihydrochloride is sourced from PubChem (CID 139785129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).