C9H5Cl3N2 — CID 143938570
2-(3,4,5-trichlorophenyl)-1H-imidazole (PubChem CID 143938570) has the molecular formula C9H5Cl3N2 and a molecular weight of 247.51 g/mol. Its IUPAC name is 2-(3,4,5-trichlorophenyl)-1H-imidazole.
| Compound Name | 2-(3,4,5-trichlorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 143938570 |
| Molecular Formula | C9H5Cl3N2 |
| Molecular Weight | 247.51 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 2-(3,4,5-trichlorophenyl)-1H-imidazole |
| SMILES | Clc1cc(-c2ncc[nH]2)cc(Cl)c1Cl |
| InChI | InChI=1S/C9H5Cl3N2/c10-6-3-5(4-7(11)8(6)12)9-13-1-2-14-9/h1-4H,(H,13,14) |
| InChIKey | IMTWGAUVPBMBLA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|