About ethane;2-phenyl-1H-imidazole
ethane;2-phenyl-1H-imidazole (PubChem CID 142210082) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is ethane;2-phenyl-1H-imidazole.
Molecular Properties
| Compound Name | ethane;2-phenyl-1H-imidazole |
| PubChem CID | 142210082 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | ethane;2-phenyl-1H-imidazole |
| SMILES | CC.CC.c1ccc(-c2ncc[nH]2)cc1 |
| InChI | InChI=1S/C9H8N2.2C2H6/c1-2-4-8(5-3-1)9-10-6-7-11-9;2*1-2/h1-7H,(H,10,11);2*1-2H3 |
| InChIKey | FJFMTFDGPRAXTL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-phenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-phenyl-1H-imidazole?
The IUPAC name of ethane;2-phenyl-1H-imidazole (CID 142210082) is ethane;2-phenyl-1H-imidazole.
What is the SMILES notation for ethane;2-phenyl-1H-imidazole?
The canonical SMILES for ethane;2-phenyl-1H-imidazole is CC.CC.c1ccc(-c2ncc[nH]2)cc1.
What is the InChIKey of ethane;2-phenyl-1H-imidazole?
The InChIKey is FJFMTFDGPRAXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.2C2H6/c1-2-4-8(5-3-1)9-10-6-7-11-9;2*1-2/h1-7H,(H,10,11);2*1-2H3.
What are the key properties of ethane;2-phenyl-1H-imidazole?
ethane;2-phenyl-1H-imidazole has a molecular weight of 204.32 g/mol, XLogP of 4.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-phenyl-1H-imidazole is sourced from PubChem (CID 142210082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).