C11H6F6N2O2 — CID 87924536
2-[3,5-bis(trifluoromethoxy)phenyl]-1H-imidazole (PubChem CID 87924536) has the molecular formula C11H6F6N2O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethoxy)phenyl]-1H-imidazole.
| Compound Name | 2-[3,5-bis(trifluoromethoxy)phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 87924536 |
| Molecular Formula | C11H6F6N2O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-[3,5-bis(trifluoromethoxy)phenyl]-1H-imidazole |
| SMILES | FC(F)(F)Oc1cc(OC(F)(F)F)cc(-c2ncc[nH]2)c1 |
| InChI | InChI=1S/C11H6F6N2O2/c12-10(13,14)20-7-3-6(9-18-1-2-19-9)4-8(5-7)21-11(15,16)17/h1-5H,(H,18,19) |
| InChIKey | MOKCYSTVGKSHRC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |