C8H4F6O2S — CID 87333511
3,5-bis(trifluoromethoxy)benzenethiol (PubChem CID 87333511) has the molecular formula C8H4F6O2S and a molecular weight of 278.17 g/mol. Its IUPAC name is 3,5-bis(trifluoromethoxy)benzenethiol.
| Compound Name | 3,5-bis(trifluoromethoxy)benzenethiol |
|---|---|
| PubChem CID | 87333511 |
| Molecular Formula | C8H4F6O2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 3,5-bis(trifluoromethoxy)benzenethiol |
| SMILES | FC(F)(F)Oc1cc(S)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C8H4F6O2S/c9-7(10,11)15-4-1-5(3-6(17)2-4)16-8(12,13)14/h1-3,17H |
| InChIKey | KDACNIPVLGIUNB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|