C9H3F9O — CID 18994644
1-(trifluoromethoxy)-3,5-bis(trifluoromethyl)benzene (PubChem CID 18994644) has the molecular formula C9H3F9O and a molecular weight of 298.10 g/mol. Its IUPAC name is 1-(trifluoromethoxy)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(trifluoromethoxy)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 18994644 |
| Molecular Formula | C9H3F9O |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 1-(trifluoromethoxy)-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H3F9O/c10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)19-9(16,17)18/h1-3H |
| InChIKey | UGRLSMQCJKPTKP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |