C8H6BF6LiO3 — CID 174626926
lithium;[3,5-bis(trifluoromethyl)phenoxy]boronic acid;hydride (PubChem CID 174626926) has the molecular formula C8H6BF6LiO3 and a molecular weight of 281.87 g/mol. Its IUPAC name is lithium;[3,5-bis(trifluoromethyl)phenoxy]boronic acid;hydride.
| Compound Name | lithium;[3,5-bis(trifluoromethyl)phenoxy]boronic acid;hydride |
|---|---|
| PubChem CID | 174626926 |
| Molecular Formula | C8H6BF6LiO3 |
| Molecular Weight | 281.87 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | lithium;[3,5-bis(trifluoromethyl)phenoxy]boronic acid;hydride |
| SMILES | OB(O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1.[H-].[Li+] |
| InChI | InChI=1S/C8H5BF6O3.Li.H/c10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)18-9(16)17;;/h1-3,16-17H;;/q;+1;-1 |
| InChIKey | DYHCQSNPGXIUMS-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.87 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|