C33H31BF6NO4P — CID 157262320
[3,5-bis(trifluoromethyl)phenoxy]boronic acid;[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane (PubChem CID 157262320) has the molecular formula C33H31BF6NO4P and a molecular weight of 661.39 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenoxy]boronic acid;[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane.
| Compound Name | [3,5-bis(trifluoromethyl)phenoxy]boronic acid;[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 157262320 |
| Molecular Formula | C33H31BF6NO4P |
| Molecular Weight | 661.39 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenoxy]boronic acid;[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
| SMILES | CC(C)(C)[C@H]1COC(c2ccccc2P(c2ccccc2)c2ccccc2)=N1.OB(O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26NOP.C8H5BF6O3/c1-25(2,3)23-18-27-24(26-23)21-16-10-11-17-22(21)28(19-12-6-4-7-13-19)20-14-8-5-9-15-20;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)18-9(16)17/h4-17,23H,18H2,1-3H3;1-3,16-17H/t23-;/m1./s1 |
| InChIKey | AXPHTPQZXLXRMG-GNAFDRTKSA-N |
| XLogP | 6.71 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.39 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|