C23H22NO2P — CID 11494541
(1R)-1-[(4R)-2-(2-diphenylphosphanylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethanol (PubChem CID 11494541) has the molecular formula C23H22NO2P and a molecular weight of 375.41 g/mol. Its IUPAC name is (1R)-1-[(4R)-2-(2-diphenylphosphanylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethanol.
| Compound Name | (1R)-1-[(4R)-2-(2-diphenylphosphanylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 11494541 |
| Molecular Formula | C23H22NO2P |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (1R)-1-[(4R)-2-(2-diphenylphosphanylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethanol |
| SMILES | C[C@@H](O)[C@H]1COC(c2ccccc2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C23H22NO2P/c1-17(25)21-16-26-23(24-21)20-14-8-9-15-22(20)27(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15,17,21,25H,16H2,1H3/t17-,21-/m1/s1 |
| InChIKey | LJYFOKMKASRULC-DYESRHJHSA-N |
| XLogP | 2.97 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|