C26H21NOP — CID 11249313
CID 11249313 (PubChem CID 11249313) has the molecular formula C26H21NOP and a molecular weight of 394.43 g/mol.
| Compound Name | CID 11249313 |
|---|---|
| PubChem CID | 11249313 |
| Molecular Formula | C26H21NOP |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C]([C@H]2COC(c3ccccc3P(c3ccccc3)c3ccccc3)=N2)[CH]1 |
| InChI | InChI=1S/C26H21NOP/c1-3-13-21(14-4-1)29(22-15-5-2-6-16-22)25-18-10-9-17-23(25)26-27-24(19-28-26)20-11-7-8-12-20/h1-18,24H,19H2/t24-/m1/s1 |
| InChIKey | QXUHPDSKTDUDET-XMMPIXPASA-N |
| XLogP | 4.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|