C27H22NOPPd — CID 134992415
diphenyl-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane;palladium (PubChem CID 134992415) has the molecular formula C27H22NOPPd and a molecular weight of 513.87 g/mol. Its IUPAC name is diphenyl-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane;palladium.
| Compound Name | diphenyl-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane;palladium |
|---|---|
| PubChem CID | 134992415 |
| Molecular Formula | C27H22NOPPd |
| Molecular Weight | 513.87 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | diphenyl-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane;palladium |
| SMILES | [Pd].c1ccc([C@H]2COC(c3ccccc3P(c3ccccc3)c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C27H22NOP.Pd/c1-4-12-21(13-5-1)25-20-29-27(28-25)24-18-10-11-19-26(24)30(22-14-6-2-7-15-22)23-16-8-3-9-17-23;/h1-19,25H,20H2;/t25-;/m1./s1 |
| InChIKey | STSVQNIRGUSIMO-VQIWEWKSSA-N |
| XLogP | 4.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|