C28H24NOP — CID 127256029
[2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane (PubChem CID 127256029) has the molecular formula C28H24NOP and a molecular weight of 421.48 g/mol. Its IUPAC name is [2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 127256029 |
| Molecular Formula | C28H24NOP |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
| SMILES | c1ccc(C[C@@H]2COC(c3ccccc3P(c3ccccc3)c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C28H24NOP/c1-4-12-22(13-5-1)20-23-21-30-28(29-23)26-18-10-11-19-27(26)31(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-19,23H,20-21H2/t23-/m1/s1 |
| InChIKey | PXKBZZCPBWBSKT-HSZRJFAPSA-N |
| XLogP | 4.83 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|