C20H17NO — CID 25010932
(4R)-4-benzyl-2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole (PubChem CID 25010932) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is (4R)-4-benzyl-2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-benzyl-2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 25010932 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (4R)-4-benzyl-2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(C[C@@H]2COC(c3cccc4ccccc34)=N2)cc1 |
| InChI | InChI=1S/C20H17NO/c1-2-7-15(8-3-1)13-17-14-22-20(21-17)19-12-6-10-16-9-4-5-11-18(16)19/h1-12,17H,13-14H2/t17-/m1/s1 |
| InChIKey | IQYXJGXDRORIRN-QGZVFWFLSA-N |
| XLogP | 4.23 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |