C20H23NO2 — CID 135432223
2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-6-tert-butylphenol (PubChem CID 135432223) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-6-tert-butylphenol.
| Compound Name | 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-6-tert-butylphenol |
|---|---|
| PubChem CID | 135432223 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-6-tert-butylphenol |
| SMILES | CC(C)(C)c1cccc(C2=N[C@@H](Cc3ccccc3)CO2)c1O |
| InChI | InChI=1S/C20H23NO2/c1-20(2,3)17-11-7-10-16(18(17)22)19-21-15(13-23-19)12-14-8-5-4-6-9-14/h4-11,15,22H,12-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | UJZNOLVKCRXMSW-HNNXBMFYSA-N |
| XLogP | 4.08 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |