C23H17NO2 — CID 46930892
4-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one (PubChem CID 46930892) has the molecular formula C23H17NO2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 4-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one.
| Compound Name | 4-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one |
|---|---|
| PubChem CID | 46930892 |
| Molecular Formula | C23H17NO2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]fluoren-9-one |
| SMILES | O=C1c2ccccc2-c2c1cccc2C1=N[C@@H](Cc2ccccc2)CO1 |
| InChI | InChI=1S/C23H17NO2/c25-22-18-10-5-4-9-17(18)21-19(22)11-6-12-20(21)23-24-16(14-26-23)13-15-7-2-1-3-8-15/h1-12,16H,13-14H2/t16-/m0/s1 |
| InChIKey | BUFQWGGJIYDQQC-INIZCTEOSA-N |
| XLogP | 4.29 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |