C16H14INO3 — CID 135070410
4-benzyl-2-(2-iodylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 135070410) has the molecular formula C16H14INO3 and a molecular weight of 395.20 g/mol. Its IUPAC name is 4-benzyl-2-(2-iodylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-benzyl-2-(2-iodylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135070410 |
| Molecular Formula | C16H14INO3 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 4-benzyl-2-(2-iodylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | O=I(=O)c1ccccc1C1=NC(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C16H14INO3/c19-17(20)15-9-5-4-8-14(15)16-18-13(11-21-16)10-12-6-2-1-3-7-12/h1-9,13H,10-11H2 |
| InChIKey | BHODSWUNQMVNQY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|