C23H22N2O — CID 102499049
N-benzyl-2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline (PubChem CID 102499049) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is N-benzyl-2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline.
| Compound Name | N-benzyl-2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
|---|---|
| PubChem CID | 102499049 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-benzyl-2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
| SMILES | c1ccc(CNc2ccccc2C2=N[C@@H](Cc3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C23H22N2O/c1-3-9-18(10-4-1)15-20-17-26-23(25-20)21-13-7-8-14-22(21)24-16-19-11-5-2-6-12-19/h1-14,20,24H,15-17H2/t20-/m0/s1 |
| InChIKey | UIXYFSSCSHEVRJ-FQEVSTJZSA-N |
| XLogP | 4.69 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |