C16H15NO2 — CID 136749627
2-(4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)phenol (PubChem CID 136749627) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)phenol.
| Compound Name | 2-(4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)phenol |
|---|---|
| PubChem CID | 136749627 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)phenol |
| SMILES | Oc1ccccc1C1=NC(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C16H15NO2/c18-15-9-5-4-8-14(15)16-17-13(11-19-16)10-12-6-2-1-3-7-12/h1-9,13,18H,10-11H2 |
| InChIKey | UFNZMLDIAQROIH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |